Identification |
Name: | 2-Propanone,1-(3,4-dihydroxyphenyl)- |
Synonyms: | 2-Propanone,(3,4-dihydroxyphenyl)- (6CI,7CI); 1-(3,4-Dihydroxyphenyl)-2-propanone;1-(3',4'-Dihydroxyphenyl)-2-propanone; 3,4-Dihydroxyphenylacetone |
CAS: | 2503-44-8 |
Molecular Formula: | C9H10 O3 |
Molecular Weight: | 166.17 |
InChI: | InChI=1/C9H10O3/c1-6(10)4-7-2-3-8(11)9(12)5-7/h2-3,5,11-12H,4H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 171.1°C |
Boiling Point: | 335.8°Cat760mmHg |
Density: | 1.251g/cm3 |
Refractive index: | 1.58 |
Specification: | Thick Yellow Oil usageEng:A metabolite of racemic 3,4-methylenedioxyethylamphetamine. |
Flash Point: | 171.1°C |
Usage: | A metabolite of racemic 3,4-methylenedioxyethylamphetamine. |
Safety Data |
|
 |