| Identification | |
| Name: | chloroethylene; 1,1-dichloroethylene; 2-ethylhexyl prop-2-enoate |
| Synonyms: | chloroethylene; 1,1-dichloroethylene; 2-ethylhexyl prop-2-enoate;AC1Q3FVH;AC1L51HC;AR-1I2046;2-Propenoic acid, 2-ethylhexyl ester, polymer with chloroethene and 1,1-dichloroethene;chloroethene; 1,1-dichloroethene; 2-ethylhexyl prop-2-enoate;Chloroethene, 1,1-dichloroethene, 2-ethylhexyl 2-propenoate polymer;Chloroethene, polymer with 1,1-dichloroethene and 2-ethylhexyl 2-propenoate |
| CAS: | 25035-95-4 |
| Molecular Formula: | C15H25Cl3O2 |
| Molecular Weight: | 343.7168 |
| InChI: | InChI=1/C11H20O2.C2H2Cl2.C2H3Cl/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-2(3)4;1-2-3/h6,10H,3-5,7-9H2,1-2H3;1H2;2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 79.4°C |
| Boiling Point: | 216°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 79.4°C |
| Safety Data | |
 |
|
