| Identification | |
| Name: | AK 222 |
| Synonyms: | 2-Propenoic acid, ethyl ester, polymer with 2-propenenitrile;Acrylic acid ethyl ester, polymer with acrylonitrile;Ethyl 2-propenoate, 2-propenenitrile polymer;Ethyl acrylate, acrylonitrile polymer |
| CAS: | 25053-12-7 |
| Molecular Formula: | C8H11NO2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C5H8O2.C3H3N/c1-3-5(6)7-4-2;1-2-3-4/h3H,1,4H2,2H3;2H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 15.6°C |
| Boiling Point: | 99.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 15.6°C |
| Safety Data | |
 |
|
