| Identification | |
| Name: | Tetradecanoic acid,2-hydroxy- |
| CAS: | 2507-55-3 |
| EINECS: | 219-714-0 |
| Molecular Formula: | C14H28 O3 |
| Molecular Weight: | 244.37 |
| InChI: | InChI=1/C14H28O3/c1-2-3-4-5-6-7-8-9-10-11-12-13(15)14(16)17/h13,15H,2-12H2,1H3,(H,16,17)/t13-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.969 g/cm3 |
| Refractive index: | 1.467 |
| Water Solubility: | Soluble in DMSO (25 mg/ml) and ethanol (25 mg/ml). |
| Solubility: | Soluble in DMSO (25 mg/ml) and ethanol (25 mg/ml). |
| Appearance: | Off-White Solid |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
