| Identification | |
| Name: | 4-Isoxazolecarboxylicacid, 3,5-dimethyl- |
| Synonyms: | 3,5-Dimethyl-4-isoxazolecarboxylicacid; 4-Carboxy-3,5-dimethylisoxazole |
| CAS: | 2510-36-3 |
| EINECS: | 219-724-5 |
| Molecular Formula: | C6H7 N O3 |
| Molecular Weight: | 141.12 |
| InChI: | InChI=1/C6H7NO3/c1-3-5(6(8)9)4(2)10-7-3/h1-2H3,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136.3°C |
| Boiling Point: | 301.8°Cat760mmHg |
| Density: | 1.276g/cm3 |
| Appearance: | light beige powder |
| Specification: |
4-Isoxazolecarboxylicacid, 3,5-dimethyl- , its cas register number is 2510-36-3. It also can be called 3,5-Dimethylisoxazole-4-carboxylic acid . 4-Isoxazolecarboxylicacid, 3,5-dimethyl- (CAS NO.2510-36-3) is a light beige powder which is harmful by inhalation, in contact with skin and if swallowed. |
| Flash Point: | 136.3°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
