| Identification |
| Name: | 9-Phenanthrenecarbonitrile |
| Synonyms: | 9-Cyanophenanthrene;9-Phenanthrenenitrile; 9-Phenanthronitrile; NSC 59773 |
| CAS: | 2510-55-6 |
| EINECS: | 219-725-0 |
| Molecular Formula: | C15H9 N |
| Molecular Weight: | 203.24 |
| InChI: | InChI=1/C15H9N/c16-10-12-9-11-5-1-2-6-13(11)15-8-4-3-7-14(12)15/h1-9H |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 110-112 °C(lit.)
|
| Flash Point: | 205.4°C |
| Boiling Point: | 175 °C / 1mmHg |
| Density: | 1.2g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. |
| Refractive index: | 1.719 |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents, strong acids, strong bases. Toxicology May be harmful or act as an irritant - toxicology not fully investigated. Tox |
| Solubility: | |
| Appearance: | yellow-green powder |
| Flash Point: | 205.4°C |
| Safety Data |
| |
 |
