| Identification | |
| Name: | Benzeneacetonitrile, a-(phenylmethylene)- |
| Synonyms: | Acrylonitrile,2,3-diphenyl- (6CI,7CI,8CI); Acrylonitrile, a,b-diphenyl- (3CI); 1-Cyano-1,2-diphenylethene; 2,3-Diphenylacrylonitrile;2,3-Diphenylpropenonitrile; Benzylidene(phenyl)acetonitrile; NSC 12489; NSC2018; a-Cyanostilbene; a-Phenylcinnamonitrile; a-Stilbenecarbonitrile |
| CAS: | 2510-95-4 |
| EINECS: | 219-726-6 |
| Molecular Formula: | C15H11 N |
| Molecular Weight: | 205.27 |
| InChI: | InChI=1/C15H11N/c16-12-15(14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-11H/b15-11- |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3439 |
| Melting Point: | 85-87 °C(lit.) |
| Flash Point: | 156.2°C |
| Boiling Point: | 333.6°Cat760mmHg |
| Density: | 1.104g/cm3 |
| Refractive index: | 1.638 |
| Specification: |
2,3-Diphenylacrylonitrile ,its cas register number is 2510-95-4. It also can be called .alpha.-Phenylcinnamonitrile ; Benzeneacetonitrile, .alpha.-(phenylmethylene)-, (E)- ; Acrylonitrile, 2,3-diphenyl-, (E)- ;and (2E)-2,3-Diphenylacrylonitrile . |
| Report: |
Reported in EPA TSCA Inventory. Cyanide and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 156.2°C |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
