Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 1,1-dichloroethene |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 1,1-dichloroethene;Methyl 2-methyl-2-propenoate polymer with 1,1-dichloroethene |
CAS: | 25120-29-0 |
Molecular Formula: | C7H10Cl2O2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C5H8O2.C2H2Cl2/c1-4(2)5(6)7-3;1-2(3)4/h1H2,2-3H3;1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 10°C |
Boiling Point: | 100.3°C at 760 mmHg |
Flash Point: | 10°C |
Safety Data |
|
 |