| Identification | |
| Name: | 1H-Indole-7-carboxylicacid, 2,3-dihydro-2,3-dioxo- |
| Synonyms: | 7-Indolinecarboxylicacid, 2,3-dioxo- (6CI,8CI); 2,3-Dioxo-2,3-dihydro-1H-indole-7-carboxylic acid;2,3-Dioxo-7-indolinecarboxylic acid; Isatin-7-carboxylic acid |
| CAS: | 25128-35-2 |
| Molecular Formula: | C9H5 N O4 |
| Molecular Weight: | 191.14 |
| InChI: | InChI=1/C9H5NO4/c11-7-4-2-1-3-5(9(13)14)6(4)10-8(7)12/h1-3H,(H,13,14)(H,10,11,12) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.592g/cm3 |
| Refractive index: | 1.66 |
| Specification: |
2,3-Dioxoindoline-7-carboxylic acid , its cas register number is 25128-35-2. It also can be called 1H-indole-7-carboxylic acid, 2,3-dihydro-2,3-dioxo- ; and 2,3-Dioxoindoline-7-carboxylic acid . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
