| Identification | |
| Name: | 1,4-Dioxane, dimethyl- |
| Synonyms: | p-Dioxane,dimethyl- (6CI,7CI,8CI); Dimethyl-1,4-dioxane; Dimethyldioxane |
| CAS: | 25136-55-4 |
| EINECS: | 246-646-9 |
| Molecular Formula: | C6H12 O2 |
| Molecular Weight: | 116.18 |
| InChI: | InChI=1/C6H12O2/c1-6(2)5-7-3-4-8-6/h3-5H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 34.8°C |
| Boiling Point: | 134.4°Cat760mmHg |
| Density: | 0.903g/cm3 |
| Refractive index: | 1.402 |
| Specification: |
Dimethyldioxane ,its cas register number is 25136-55-4. It also can be called Dimethyl-1,4-dioxane ; p-Dioxane, dimethyl- ;and 1,4-Dioxane, dimethyl-Dimethyl-1,4-dioxane . Dimethyldioxane (CAS NO.25136-55-4) only can be used if position of methyl group unspecified. It forms salts with strong acids and addition complexes with Lewis acids, and will be easily ignited by heat, sparks or flames. Vapors may form explosive mixtures with air. Vapors may travel to source of ignition and flash back. Most vapors are heavier than air. They will spread along ground and collect in low or confined areas (sewers, basements, tanks). |
| Flash Point: | 34.8°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
