| Identification | |
| Name: | Benzamide,4-(dimethylamino)-N-[7-(hydroxyamino)-7-oxoheptyl]- |
| Synonyms: | MS 344;M 344 (enzyme inhibitor); |
| CAS: | 251456-60-7 |
| Molecular Formula: | C16H25N3O3 |
| Molecular Weight: | 307.39 |
| InChI: | InChI=1/C16H25N3O3/c1-19(2)14-10-8-13(9-11-14)16(21)17-12-6-4-3-5-7-15(20)18-22/h8-11,22H,3-7,12H2,1-2H3,(H,17,21)(H,18,20) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.137g/cm3 |
| Refractive index: | 1.558 |
| Biological Activity: | Histone deacetylase inhibitor (IC 50 = 100 nM). Induces terminal cell differentiation and causes an increase in hyperacetylated histone H4. Antiproliferative agent; suppresses the growth of human endometrial and ovarian cancer cells by inducing cell cycle arrest and apoptosis. |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
