| Identification | |
| Name: | 3-Ethyl-1-methyl-1,3-cyclopentadiene |
| Synonyms: | 3-ethyl-1-methylcyclopenta-1,3-diene;1,3-cyclopentadiene, 3-ethyl-1-methyl-; |
| CAS: | 25148-01-0 |
| Molecular Formula: | C8H12 |
| Molecular Weight: | 108.18 |
| InChI: | InChI=1/C8H12/c1-3-8-5-4-7(2)6-8/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 17 ºC |
| Boiling Point: | 133 ºC |
| Density: | 0.839 |
| Refractive index: | 1.475 |
| Specification: |
The 3-Ethyl-1-methyl-1,3-cyclopentadiene with the cas number 25148-01-0, is also called 3-ethyl-1-methylcyclopenta-1,3-diene .The properties of this chemical are: (1)#Freely Rotating Bonds: 1 ; (2)Index of Refraction: 1.475 ; (3)Molar Refractivity: 36.29 cm3 ; (4)Molar Volume: 128.8 cm3 ; (5)Polarizability: 14.38 10-24cm3 ; (6)Surface Tension: 25.1 dyne/cm ; (7)Enthalpy of Vaporization: 35.53 kJ/mol ; (8)Vapour Pressure: 10.6 mmHg at 25°C . You can still convert the following datas into molecular structure : |
| Flash Point: | 17 ºC |
| Safety Data | |
 |
|
