Identification |
Name: | N-Methylbenzene-1,2-diamine dihydrochloride |
Synonyms: | 1,2-Benzenediamine,N-methyl-, dihydrochloride (9CI);o-Phenylenediamine, N-methyl-,dihydrochloride (8CI);1-Amino-2-methylaminobenzene dihydrochloride;N-Methyl-1,2-diaminobenzenedihydrochloride;N-Methyl-o-phenylenediamine dihydrochloride;N-methyl-O-phenylenediamine 2HCL; |
CAS: | 25148-68-9 |
EINECS: | 246-655-8 |
Molecular Formula: | C7H10N2.2(HCl) |
Molecular Weight: | 195.09 |
InChI: | InChI=1/C7H10N2.2ClH/c1-9-7-5-3-2-4-6(7)8;;/h2-5,9H,8H2,1H3;2*1H |
Molecular Structure: |
|
Properties |
Stability: | Stable under normal temperatures and pressures. |
Solubility: | H2O:>=10 g/100 mL at 23 oC |
Appearance: | White or Pink Crystal |
Specification: |
?N-Methylbenzene-1,2-diamine dihydrochloride (CAS NO.25148-68-9) is an acidic salt. Materials in this group are generally soluble in water. The resulting solutions contain moderate concentrations of hydrogen ions and have pH's of less than 7.0. They react as acids to neutralize bases. These neutralizations generate heat, but less or far less than is generated by neutralization of inorganic acids, inorganic oxoacids, and carboxylic acid. They usually do not react as either oxidizing agents or reducing agents but such behavior is not impossible. Many of these compounds?are usually used as catalysator in organic reactions.
|
Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
|
|