| Identification | |
| Name: | Sokrat CHDF 2802 |
| Synonyms: | 2-Propenoic acid, 2-ethylhexyl ester, polymer with ethenylbenzene;STYRENE-2-ETHYLHEXYLACRYLATECOPOLYMER;Benzene, ethenyl-, polymer with 2-ethylhexyl 2-propenoate;Ethenylbenzene, 2-ethylhexyl 2-propenoate copolymer;2-ETHYLHEXYL ESTER, ACRYLIC ACID POLYMER WITH STYRENE;2-Ethylhexyl acrylate-styrene copolymers;styrene/ 2-ethylhexyl acrylate resin |
| CAS: | 25153-46-2 |
| Molecular Formula: | C19H28O2 |
| Molecular Weight: | 288.42442 |
| InChI: | InChI=1S/C11H20O2.C8H8/c1-4-7-8-10(5-2)9-13-11(12)6-3;1-2-8-6-4-3-5-7-8/h6,10H,3-5,7-9H2,1-2H3;2-7H,1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 79.4°C |
| Boiling Point: | 216°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 79.4°C |
| Safety Data | |
 |
|
