| Identification |
| Name: | Phenol, nonyl- |
| Synonyms: | 2,6-Dimethyl-4-heptylphenol, (O and P);Monononylphenol;Nonanal-methyl anthranilate; |
| CAS: | 25154-52-3 |
| EINECS: | 246-672-0 |
| Molecular Formula: | C15H24O |
| Molecular Weight: | 220.35 |
| InChI: | InChI=1S/C15H24O/c1-11(2)9-12(3)10-13(4)14-5-7-15(16)8-6-14/h5-8,11-13,16H,9-10H2,1-4H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 195kgs |
| Density: | 0.929 g/cm3 |
| Refractive index: | 1.505 |
| Water Solubility: | Insoluble in water, slightly soluble in petroleum ether, acetone, carbon tetrachloride, ethanol and chloroform |
| Solubility: | Insoluble in water, slightly soluble in petroleum ether, acetone, carbon tetrachloride, ethanol and chloroform |
| Appearance: | Light yellow viscous liquid |
| Packinggroup: | III |
| Color: | Pale yellow viscous liquid /Nonylphenol/ |
| Safety Data |
| |
 |
