| Identification | |
| Name: | Benzene,methyl(1-methylethyl)- |
| Synonyms: | Cymene(8CI); Cymol; Isopropyltoluene; Methyl(1-methylethyl)benzene;Methylisopropylbenzene |
| CAS: | 25155-15-1 |
| EINECS: | 246-674-1 |
| Molecular Formula: | C10H14 |
| Molecular Weight: | 134.2182 |
| InChI: | InChI=1/C10H14/c1-8(2)10-6-4-9(3)5-7-10/h4-8H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 47.2°C |
| Boiling Point: | 173.9°Cat760mmHg |
| Density: | 0.861g/cm3 |
| Refractive index: | 1.492 |
| Solubility: | Miscible with ethanol, ether, and acetone In water, 23.3 mg/l @ 25 deg C. |
| Flash Point: | 47.2°C |
| Safety Data | |
 |
|
