| Identification | |
| Name: | n-Butoxyacetic acid |
| Synonyms: | Aceticacid, butoxy- (6CI,7CI,8CI,9CI); 2-Butoxyacetic acid; Butoxy acetic acid;Butyloxyacetic acid; NSC 10980 |
| CAS: | 2516-93-0 |
| Molecular Formula: | C6H12O3 |
| Molecular Weight: | 132.15768 |
| InChI: | InChI=1S/C6H12O3/c1-2-3-4-9-5-6(7)8/h2-5H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1760 |
| Density: | 1.017 |
| Refractive index: | 1.425-1.427 |
| Water Solubility: | very soluble in water |
| Solubility: | very soluble in water |
| Appearance: | Clear light yellow liquid. Acetic odor. |
| Specification: | clear colorless to light yellow liquid Safety Statements:36/37/39 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
