Identification |
Name: | 2,4-Methano-4H-furo[3,2-b]pyrrol-3-amine,hexahydro-N-methyl-, (2R,3R,3aS,4S,6aS)- |
Synonyms: | 2,4-Methano-4H-furo[3,2-b]pyrrol-3-amine,hexahydro-N-methyl-, [2R-(2a,3a,3ab,4a,6ab)]-;2,4-Methano-4H-furo[3,2-b]pyrrole, hexahydro-3-(methylamino)- (7CI); Loline(6CI,8CI); (+)-Loline; Festucine |
CAS: | 25161-91-5 |
Molecular Formula: | C8H14 N2 O |
Molecular Weight: | 154.24 |
InChI: | InChI=1S/C8H14N2O/c1-9-7-6-4-10-3-2-5(11-6)8(7)10/h5-9H,2-4H2,1H3/t5?,6-,7+,8-/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 94.5°C |
Boiling Point: | 232.6°Cat760mmHg |
Density: | 1.2g/cm3 |
Specification: |
Loline ,its cas register number is 25161-91-5. It also can be called Festucine ; and Methyl-N-depropionyldecorticasine .
|
Flash Point: | 94.5°C |
Safety Data |
Hazard Symbols |
|
|
|