| Identification | |
| Name: | Phenol, chloro- |
| Synonyms: | Chlorophenol;Monochlorophenol |
| CAS: | 25167-80-0 |
| EINECS: | 246-691-4 |
| Molecular Formula: | C6H5 Cl O |
| Molecular Weight: | 173.0073 |
| InChI: | InChI=1/C6H5BrO/c7-5-3-1-2-4-6(5)8/h1-4,8H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 9.8 deg C |
| Flash Point: | 69.3°C |
| Boiling Point: | 194.5°Cat760mmHg |
| Density: | 1.662g/cm3 |
| Refractive index: | 1.604 |
| Solubility: | Sol in ethanol, ethyl ether; slightly soluble in chloroform; very sol in benzene Sol in aqueous sodium hydroxide, alcohol, ether 2.85 PARTS SOL IN 100 PARTS WATER @ 20 DEG C Freely soluble in alcohol, ether, caustic alkali solutions Soluble in aqueous alkali, oxygenated and aromatic solvents In water, 1.13X10+4 mg/L at 25 deg C |
| Flash Point: | 69.3°C |
| Color: | Light amber liquid Colorless to yellow brown liquid |
| Safety Data | |
 |
|
