| Identification | |
| Name: | Naphthalenamine |
| Synonyms: | Naphthylamine(8CI); Aminonaphthalene |
| CAS: | 25168-10-9 |
| Molecular Formula: | C10H9 N |
| Molecular Weight: | 143.1852 |
| InChI: | InChI=1/C10H9N/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,11H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 49.2 deg C |
| Flash Point: | 152.1°C |
| Boiling Point: | 301°Cat760mmHg |
| Density: | 1.137g/cm3 |
| Solubility: | Sol in chloroform Freely sol in alcohol and ether In water, 1.7X10+3 mg/L @ 20 deg C |
| Flash Point: | 152.1°C |
| Color: | Needles from ethanol (aq) or ether YELLOW RHOMBIC NEEDLES White crystals becoming red on exposure to air Needles, becoming red on exposure to air, or a reddish, crystal mass Colorless crystals; darkens in air to a reddish-purple color |
| Safety Data | |
 |
|
