| Identification |
| Name: | Isooctyl 2,4-dichlorophenoxyacetate |
| Synonyms: | 2,4-D isooctyl ester |
| CAS: | 25168-26-7 |
| EINECS: | 246-704-3 |
| Molecular Formula: | C16H22Cl2O3 |
| Molecular Weight: | 333.25 |
| InChI: | InChI=1/C16H22Cl2O3/c1-3-5-6-12(4-2)10-21-16(19)11-20-15-8-7-13(17)9-14(15)18/h7-9,12H,3-6,10-11H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 |
| Melting Point: | 12 |
| Density: | 1.15 g/cm3 |
| Stability: | At pH 9 @ 20 C, half-life in distilled water is 37 hr; at pH 6 @ 20 C, in distilled water is 1500 days. Shelf life of ester formulations varies, depending on the emulsifying system. Some retain satisfactory emulsifying properties after 3 yr. |
| Refractive index: | 1.506 |
| Solubility: | <0.1 g/100 mL at 21 ºC in water |
| Appearance: | White crystals in commerce, a brown or dark brown liquid. |
| Packinggroup: | III |
| Storage Temperature: | Store at ambient temperatures with open venting. |
| Color: | Golden yellow, non viscous liquid |
| Usage: | Herbicide. |
| Safety Data |
| Hazard Symbols |
T:Toxic
|
| |
 |
