Identification |
Name: | Poly[oxy(methyl-1,2-ethanediyl)],a-(1-oxooctadecyl)-w-hydroxy- |
Synonyms: | Glycols,polypropylene, monostearate (8CI); Stearic acid, monoester with polypropylene glycol(8CI); Atlas G 3608; Cetasal; Homotex PS 90; Koster K 9P; Novanik SPO;Oxypropylated stearic acid; Polyoxypropylene glycol monostearate;Polyoxypropylene stearate; Polyoxypropylene stearyl ester; Polypropylene glycolmonostearate; Polypropylene glycol, stearate; Prolam MR 216; Slovacid 44P |
CAS: | 25190-52-7 |
Molecular Formula: | (C3H6 O)n C18 H36 O2 |
Molecular Weight: | 0 |
InChI: | InChI=1S/C21H42O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-21(23)24-20-17-19-22/h22H,2-20H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 150.7°C |
Boiling Point: | 416.3°Cat760mmHg |
Density: | 0.91g/cm3 |
Flash Point: | 150.7°C |
Safety Data |
|
 |