| Identification | |
| Name: | Resyn 25-2211 |
| Synonyms: | 2-Propenoic acid, ethyl ester, polymer with ethenyl acetate;Acetic acid, ethenyl ester, 2-propenoic acid, ethyl ester polymer;Ethenyl acetate, polymer with ethyl 2-propenoate;Ethenyl acetate,polymer with ethyl 2-propenoate |
| CAS: | 25190-97-0 |
| Molecular Formula: | C9H14O4 |
| Molecular Weight: | 186.20506 |
| InChI: | InChI=1S/C5H8O2.C4H6O2/c1-3-5(6)7-4-2;1-3-6-4(2)5/h3H,1,4H2,2H3;3H,1H2,2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 15.6°C |
| Boiling Point: | 99.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 15.6°C |
| Safety Data | |
 |
|
