| Identification | |
| Name: | L-Alanine, homopolymer |
| Synonyms: | Alanine,L-, peptides (8CI); Alanine homopolymer; L-Alanine polymer; Poly(L-alanine)homopolymer; Poly(a-L-alanine); Poly-L-alanine; Polyalanine |
| CAS: | 25191-17-7 |
| Molecular Formula: | C3 H7 N O2 |
| Molecular Weight: | 89.0932 |
| InChI: | InChI=1S/C3H7NO2/c1-2(4)3(5)6/h2H,4H2,1H3,(H,5,6)/t2-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 82.6°C |
| Density: | 1.161 g/cm3 |
| Water Solubility: | Soluble in Dichloro acetic acid and water |
| Solubility: | Soluble in Dichloro acetic acid and water |
| Flash Point: | 82.6°C |
| Color: | Orthorhombic crystals from water White crystalline powder |
| Safety Data | |
 |
|
