| Identification | |
| Name: | Encyprate |
| Synonyms: | ethyl N-benzyl-N-cyclopropylcarbamate;Carbamic acid, cyclopropyl(phenylmethyl)-, ethyl ester;Encypratum;Ethyl N-benzyl-N-cyclopropylcarbamate |
| CAS: | 2521-01-9 |
| Molecular Formula: | C13H17 N O2 |
| Molecular Weight: | 219.31 |
| InChI: | InChI=1/C13H17NO2/c1-2-16-13(15)14(12-8-9-12)10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 149.8°C |
| Boiling Point: | 324.1°Cat760mmHg |
| Density: | 1.11g/cm3 |
| Refractive index: | 1.551 |
| Specification: |
Ethyl N-benzylcyclopropanecarbamate , its cas register number is 2521-01-9. It also can be called A-19757 ; BRN 2648343 ; Carbamic acid, cyclopropyl(phenylmethyl)-, ethyl ester ; Enciprato ; Encyprate ; Encypratum ; Ethyl N-benzyl-N-cyclopropylcarbamate ; MO-1255 ; NSC 169504 ; NSC 43799 ; UNII-26991ZCA4G . When heated to decomposition it emits toxic fumes of NOx. |
| Flash Point: | 149.8°C |
| Safety Data | |
 |
|
