| Identification | |
| Name: | 2-Furancarboxylic acid,5-bromo-, methyl ester |
| Synonyms: | 2-Furoicacid, 5-bromo-, methyl ester (6CI,7CI,8CI); 5-Bromo-2-furoic acid methyl ester;5-Bromofuran-2-carboxylic acid methyl ester; Methyl 2-bromo-5-furancarboxylate;Methyl 5-bromo-2-furoate; Methyl 5-bromofuran-2-carboxylate |
| CAS: | 2527-99-3 |
| Molecular Formula: | C6H5 Br O3 |
| Molecular Weight: | 205.00 |
| InChI: | InChI=1/C6H5BrO3/c1-9-6(8)4-2-3-5(7)10-4/h2-3H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.623 g/cm3 |
| Refractive index: | 1.513 |
| Appearance: | White to slightly yellow crystalline powder |
| Specification: |
2-Furancarboxylic acid,5-bromo-, methyl ester , with CAS number of 2527-99-3, can be called Rarechem al bf 0601 ; buttpark 94\04-07 ; methyl-2-bromofuran-carboxylate ; methyl 5-bromofuran-2-carboxylate ; methyl 5-bromo-2-furoate ; 5-bromo-2-furoic acid methyl ester ; 5-bromo-furan-2-carboxylic acid methyl ester ; akos bbs-00004656 .It is a white to slightly yellow crystalline powder. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
