| Identification | |
| Name: | 2-Propenoic acid |
| Synonyms: | methyl acrylate copolymer anionic surfactant;polymer with methyl 2-propenoate Acrylic acid;polymer with methyl 2-propenoate Acrylic acidmethyl acrylate copolymer 2-Propenoic acid;2-Propenoic acid, polymer with methyl 2-propenoate;Propenoic-2-acid polymer with methylprop-2-enoatom;methyl acrylate/ acrylic acid copolymer |
| CAS: | 25302-81-2 |
| Molecular Formula: | C7H10O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C4H6O2.C3H4O2/c1-3-4(5)6-2;1-2-3(4)5/h3H,1H2,2H3;2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 6.7°C |
| Boiling Point: | 80.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 6.7°C |
| Safety Data | |
 |
|
