| Identification | |
| Name: | Phenanthrene, 2-methyl- |
| Synonyms: | 2-Methylphenanthrene;NSC 89276 |
| CAS: | 2531-84-2 |
| EINECS: | 219-791-0 |
| Molecular Formula: | C15H12 |
| Molecular Weight: | 192.27 |
| InChI: | InChI=1/C15H12/c1-11-6-9-15-13(10-11)8-7-12-4-2-3-5-14(12)15/h2-10H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 57ºC |
| Density: | 1.105 g/cm3 |
| Refractive index: | 1.693 |
| Appearance: | white Crystalline solid |
| Specification: |
2-Methylphenanthrene (CAS No.2531-84-2) vigorous reactions, sometimes amounting to explosions, can result from the contact between aromatic hydrocarbons, such as 2-METHYLPHENANTHRENE, and strong oxidizing agents. They can react exothermically with bases and with diazo compounds. Substitution at the benzene nucleus occurs by halogenation (acid catalyst), nitration, sulfonation, and the Friedel-Crafts reaction. It may be sensitive to prolonged exposure to light. |
| Safety Data | |
 |
|
