| Identification | |
| Name: | Benzene, methyldinitro- |
| Synonyms: | Toluene,ar,ar-dinitro- (8CI);DNT;Dinitrophenylmethane;Dinitrotoluene;Dinitrotoluol;Methyldinitrobenzene; |
| CAS: | 25321-14-6 |
| EINECS: | 204-450-0 |
| Molecular Formula: | C7H6 N2 O4 |
| Molecular Weight: | 182.1 |
| InChI: | InChI=1/C8H8N2O4/c1-5-3-4-7(9(11)12)8(6(5)2)10(13)14/h3-4H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 65 - 90 C |
| Flash Point: | 207 C |
| Boiling Point: | 250 - 300 C |
| Density: | 1.407 g/cm3 |
| Refractive index: | 1.587 |
| Water Solubility: | Very slightly |
| Solubility: | Very slightly |
| Appearance: | light yellow crystalline solid |
| Specification: |
Dinitrotoluene (25321-14-6) is an organic compound with the formula C6H3(CH3)(NO2)2. This pale yellow crystalline solid is well known as a precursor to trinitrotoluene (TNT) but is mainly used in the polymer industry.It is used in the production of toluene diisocyanate which is used to produce flexible polyurethane foams.and it is hydrogenated to produce toluenediamine, which in turn is phosgenated to form toluene diisocyanate. Other uses include the explosives industry. It is not used by itself as an explosive, but some of the production is converted to TNT.It is frequently used as a plasticizer, deterrent coating, and burn rate modifier in propellants (eg. smokeless gunpowders). As it is carcinogenic and toxic, modern formulations tend to avoid its use. In this application it is often used together with dibutyl phthalate. |
| Report: |
Reported in EPA TSCA Inventory. EPA Genetic Toxicology Program. |
| Packinggroup: | II |
| Flash Point: | 207 C |
| Color: | Yellow needles or monoclinic prisms Yellow or orange crystals |
| Safety Data | |
| Hazard Symbols |
6.1
(Packing group: II)
UN
NO.
|
 |
|
