| Identification | |
| Name: | Benzene, dichloro- |
| Synonyms: | Amisia-mottenschutz;DCB; Dichlorobenzene; Dilatin DBI; Mott-Ex; Mottenschutzmittel Evau P; Rotamott |
| CAS: | 25321-22-6 |
| EINECS: | 246-837-7 |
| Molecular Formula: | C6H4 Cl2 |
| Molecular Weight: | 147.00196 |
| InChI: | InChI=1/C6H4Cl2/c7-5-3-1-2-4-6(5)8/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 65.6°C |
| Boiling Point: | 180.5°Cat760mmHg |
| Density: | 1.297g/cm3 |
| Solubility: | Miscible with alcohol, ether, benzene. In water, 156 mg/L at 25 deg C |
| Flash Point: | 65.6°C |
| Color: | Colorless liquid Colorless to pale-yellow liquid ... |
| Safety Data | |
 |
|
