| Identification | |
| Name: | Ethene, dichloro- (9CI) |
| Synonyms: | Ethylene,dichloro- (8CI); Dichloroethene; Dichloroethylene |
| CAS: | 25323-30-2 |
| Molecular Formula: | C2H2 Cl2 |
| Molecular Weight: | 97.9517 |
| InChI: | InChI=1S/C6H14O3/c1-5(8)4-9-6(2)3-7/h5-8H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1150 |
| Solubility: | Lower molecular weight members are sol in water Infinite In water: PPG 425, >10,000 mg/L; PPG 1000, >1,000 mg/L; PPG 2000, 250 mg/L; PPG 2700, 15 mg/L [West RJ et al; Environ Toxicol Chem 26: 862-71 (2007)] PubMed Abstract |
| Specification: |
Dichloroethene often abbreviated as DCE, can refer to any one of several isomeric forms of the organochloride with the molecular formula C2H2Cl2 and the molecular structure : 1,1-Dichloroethene; cis-1,2-Dichloroethene ; and trans-1,2-Dichloroethene . It also called for Dichloroethylene ; HSDB 6878 ; Ethene, dichloro- ; Ethene, dichloro- (9CI) ; Ethylene, dichloro- ; 1,2-Dichloroethylene [UN1150] [Flammable liquid] ; UN1150 . |
| Packinggroup: | II |
| Color: | Clear, lightly colored, slightly oily, viscous liquids |
| Safety Data | |
 |
|
