Identification |
Name: | Dianhydromannitol monooleate |
Synonyms: | dianhydro-,mono-9-octadecenoate,(z)-d-mannito;mannide;MANNIDE MONOOLEATE;ARLACEL;Arlacel A;ARLACEL(R) A;dianhydro-D-mannitol monooleate;D-Mannitol, dianhydro-, mono-(9Z)-9-octadecenoate |
CAS: | 25339-93-9 |
EINECS: | 246-872-8 |
Molecular Formula: | C24H44O7 |
Molecular Weight: | 428.6 |
InChI: | InChI=1/C24H44O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)31-24-23(29)22(28)21(27)19(18-25)30-24/h9-10,19,21-25,27-29H,2-8,11-18H2,1H3/b10-9-/t19-,21-,22+,23-,24?/m1/s1 |
Molecular Structure: |
|
Properties |
Flash Point: | 182.6°C |
Boiling Point: | 100 °C |
Density: | 0.97 |
Stability: | Stable, but light and air sensitive. Combustible. Incompatible with strong oxidizing agents. |
Refractive index: | 1.518 |
Solubility: | |
Appearance: | amber liquid |
Flash Point: | 182.6°C |
Color: | yellow to brown |
Safety Data |
|
|