| Identification |
| Name: | 5-Cyclohexene-1,2,3,4-tetrol,(1R,2S,3S,4R)-rel- |
| CAS: | 25348-64-5 |
| Molecular Formula: | C6H10O4 |
| Molecular Weight: | 146.1412 |
| InChI: | InChI=1/C6H10O4/c7-3-1-2-4(8)6(10)5(3)9/h1-10H/t3-,4-,5+,6+/m0/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 201-203 |
| Density: | 1.666 g/cm3 |
| Refractive index: | 1.693 |
| Usage: | Conduritol b acts on b-glucosidases from widely differing sources to show a loss of enzymic activity: from various Aspergillus species, yeast, snail, sweet almonds, and mammals. The other enzymes that have been found to be covalently inhibited are |
| Safety Data |
| |
 |
