| Identification | |
| Name: | Diacetin |
| Synonyms: | 1,2,3-Propanetriol,esters,diacetate;Estol 1582;[(2S)-2-acetyloxy-3-hydroxy-propyl] acetate;Estol 1583;(3-acetyloxy-2-hydroxy-propyl) acetate;[(2R)-2-acetyloxy-3-hydroxy-propyl] acetate;Glycerol diacetate; |
| CAS: | 25395-31-7 |
| EINECS: | 246-941-2 |
| Molecular Formula: | C7H12O5 |
| Molecular Weight: | 176.17 |
| InChI: | InChI=1/C7H12O5/c1-5(9)11-4-7(3-8)12-6(2)10/h7-8H,3-4H2,1-2H3 |
| Molecular Structure: | ![(C7H12O5) 1,2,3-Propanetriol,esters,diacetate;Estol 1582;[(2S)-2-acetyloxy-3-hydroxy-propyl] acetate;Estol 158...](https://img.guidechem.com/casimg/25395-31-7.gif) |
| Properties | |
| Density: | 1.1875 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.44-1.45 |
| Solubility: | Very soluble |
| Appearance: | absorption near colorless, transparent oily liquid |
| Specification: |
Diacetin (CAS NO.25395-31-7) also can be called AI3-00676 ; Diacetylglycerol ; Estol 1582 ; Estol 1583 ; Glycerin diacetate ; Glycerine diacetate ; Glycerol diacetate ; Glyceryl diacetate ; 1,2,3-Propanetriol, diacetate . Diacetin (CAS NO.25395-31-7) can be stable under normal temperature and pressure conditions. It is not compatible with strong oxidizing agents and not be exposured to moist air or water. And also prevent it to broken down into hazardous decomposition products: carbon dioxide, carbon monoxide. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29153930 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Sensitive: | Hygroscopic |
| Usage: | Technical grade as a plasticizer and softening agent, and as a solvent. |
| Safety Data | |
 |
|
