| Identification | |
| Name: | Benz[a]anthracene,6-fluoro-7-methyl- |
| Synonyms: | 6-Fluoro-7-methylbenz[a]anthracene |
| CAS: | 2541-68-6 |
| Molecular Formula: | C19H13 F |
| Molecular Weight: | 260.32 |
| InChI: | InChI=1/C19H13F/c1-12-15-8-4-2-6-13(15)10-17-16-9-5-3-7-14(16)11-18(20)19(12)17/h2-11H,1H3 |
| Molecular Structure: | ![(C19H13F) 6-Fluoro-7-methylbenz[a]anthracene](https://img1.guidechem.com/chem/e/dict/34/2541-68-6.jpg) |
| Properties | |
| Flash Point: | 199.4°C |
| Boiling Point: | 452.4°C at 760 mmHg |
| Density: | 1.226g/cm3 |
| Refractive index: | 1.728 |
| Specification: |
6-Fluoro-7-methylbenz(a)anthracene , its cas register number is 2541-68-6. It also can be called BRN 2532106 ; Benz(a)anthracene, 6-fluoro-7-methyl- . When 6-Fluoro-7-methylbenz(a)anthracene (CAS NO.2541-68-6) is heated to decomposition, it emits toxic fumes of F−. |
| Flash Point: | 199.4°C |
| Safety Data | |
 |
|
