| Identification | |
| Name: | Glycine,N-(2-bromo-1-oxopropyl)-, ethyl ester |
| Synonyms: | Glycine,N-(2-bromopropionyl)-, ethyl ester (8CI); 2-Bromopropionylglycine ethyl ester; a-Bromopropionylglycine ethylester |
| CAS: | 25413-02-9 |
| Molecular Formula: | C7H12 Br N O3 |
| Molecular Weight: | 238.11 |
| InChI: | InChI=1/C7H12BrNO3/c1-3-12-6(10)4-9-7(11)5(2)8/h5H,3-4H2,1-2H3,(H,9,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 144.6°C |
| Boiling Point: | 315.4°C at 760 mmHg |
| Density: | 1.425g/cm3 |
| Refractive index: | 1.481 |
| Specification: |
Ethyl (2-bromopropionamido)acetate , its cas register number is 25413-02-9. It also can be called CCRIS 1821 ; Glycine, N-(2-bromo-1-oxopropyl)-, ethyl ester and so on. When Ethyl (2-bromopropionamido)acetate (CAS NO.25413-02-9) is heated to decomposition, it emits toxic vapors of NOx and Br−. |
| Flash Point: | 144.6°C |
| Safety Data | |
 |
|
