| Identification | |
| Name: | 1-Butanamine,N-nitroso-N-propyl- |
| Synonyms: | Butylamine,N-nitroso-N-propyl- (7CI,8CI); N-(Nitrosobutyl)propylamine;N-Nitroso-N-butyl-N-propylamine; N-Nitroso-N-propylbutylamine;N-Propyl-N-butylnitrosamine |
| CAS: | 25413-64-3 |
| Molecular Formula: | C7H16 N2 O |
| Molecular Weight: | 144.25 |
| InChI: | InChI=1/C7H16N2O/c1-3-5-7-9(8-10)6-4-2/h3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 94.1°C |
| Boiling Point: | 232.1°Cat760mmHg |
| Density: | 0.92g/cm3 |
| Refractive index: | 1.454 |
| Specification: |
N-Propyl-N-butylnitrosamine , its cas register number is 25413-64-3. It also can be called N-(Nitrosobutyl)propylamine ; N-Nitroso-N-butyl-N-propylamine ; and Butylamine, N-nitroso-N-propyl- . |
| Report: |
EPA Genetic Toxicology Program. |
| Flash Point: | 94.1°C |
| Safety Data | |
 |
|
