| Identification |
| Name: | 5-Pyrimidinecarboxylicacid, 1,2,3,4-tetrahydro-4-(3-hydroxyphenyl)-6-methyl-2-thioxo-, ethyl ester,(4S)- |
| Synonyms: | (4S)-Monastrol;(S)-Monastrol; Monastrol |
| CAS: | 254753-54-3 |
| Molecular Formula: | C14H16 N2 O3 S |
| Molecular Weight: | 292.35 |
| InChI: | InChI=1/C14H16N2O3S/c1-3-19-13(18)11-8(2)15-14(20)16-12(11)9-5-4-6-10(17)7-9/h4-7,12,17H,3H2,1-2H3,(H2,15,16,20) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 185-185.9 °C(lit.)
|
| Flash Point: | 220.7°C |
| Boiling Point: | 441.3°Cat760mmHg |
| Density: | 1.34g/cm3 |
| Refractive index: | 1.648 |
| Biological Activity: | Potent, cell-permeable, small molecule mitosis inhibitor that does not interact with tubulin. Arrests cells in mitosis and specifically inhibits the motility of the mitotic kinesin Eg5, a motor protein required for mitotic spindle formation and maintenance (IC 50 = 14 μ M). |
| Flash Point: | 220.7°C |
| Storage Temperature: | 2-8°C |
| Usage: | A cell-permeablesmall molecule inhibitor of the mitotic kinesin, Eg5, arrests cells in mitosis with monoastral spindles |
| Safety Data |
| |
 |
