| Identification |
| Name: | Vinyl chloroacetate |
| Synonyms: | Vinyl chloroacetate, (Chloroacetic acid vinyl ester); Chloroacetic acid vinyl ester; vinyl monochloroacetate |
| CAS: | 2549-51-1 |
| EINECS: | 219-834-3 |
| Molecular Formula: | C4H5ClO2 |
| Molecular Weight: | 120.5343 |
| InChI: | InChI=1S/C4H5ClO2/c1-2-7-4(6)3-5/h2H,1,3H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2589 |
| Melting Point: | -68 |
| Density: | 1.192 |
| Refractive index: | 1.444 |
| Water Solubility: | Stability Readily polymerizes; may be stabilized by the addition of 4-methoxyphenol. Flammable. Incompatible with strong oxidizing agents, free radical initiators, w |
| Solubility: | Insoluble in water |
| Appearance: | colourless liquid |
| Packinggroup: | II |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
