| Identification | |
| Name: | Benzylacetone |
| Synonyms: | 1-Phenyl-3-butanone;2-Phenylethyl methyl ketone;4-Phenyl-2-butanone; |
| CAS: | 2550-26-7 |
| EINECS: | 219-847-4 |
| Molecular Formula: | C10H12O |
| Molecular Weight: | 148.2 |
| InChI: | InChI=1/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -13 |
| Density: | 0.9875 |
| Stability: | No data. |
| Refractive index: | 1.51-1.513 |
| Water Solubility: | PRACTICALLY INSOLUBLE |
| Solubility: | practically insoluble in water |
| Appearance: | clear colorless to pale yellowish liquid |
| Specification: |
?Benzylacetone (CAS NO.2550-26-7) is also named as?1-Phenyl-3-butanone ;??4-07-00-00713 (Beilstein Handbook Reference) ; 4-Phenylbutan-2-one ; AI3-15123 ; BRN 1907123 ;?Methyl 2-phenylethyl ketone ; Methyl phenethyl ketone ; Methyl phenylethyl ketone ; NSC 44829 ; NSC 813 ; Phenethyl methyl ketone ; beta-Phenylethyl methyl ketone?.?Benzylacetone (CAS NO.2550-26-7) is clear colorless to pale yellowish liquid?with a sweet, flowery smell. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29143900 |
| Storage Temperature: | Store in a cool, dry place. Store in a tightly closed container. |
| Usage: | Used like an attractant for melon flies and in perfume. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
