| Identification |
| Name: | 4-Piperidinecarboxylicacid, 1-acetyl- |
| Synonyms: | 1-Acetylpiperidine-4-carboxylic acid;Isonipecoticacid, 1-acetyl- (8CI);1-Acetylisonipecotic acid;4-Acetylpiperidine-1-carboxylic acid;N-Acetylisonipecotic acid;N-Acetylisonipecotinic acid;N-Acetylpiperidine-4-carboxylic acid; |
| CAS: | 25503-90-6 |
| EINECS: | 247-049-6 |
| Molecular Formula: | C8H13NO3 |
| Molecular Weight: | 171.2 |
| InChI: | InChI=1/C8H13NO3/c1-6(10)9-4-2-7(3-5-9)8(11)12/h7H,2-5H2,1H3,(H,11,12) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 180ºC |
| Boiling Point: | 374ºC at 760 mmHg |
| Density: | 1.213 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Solubility: | 50 g/L (20 ºC) |
| Appearance: | White crystalline powder crystalline powder. |
| Flash Point: | 180ºC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | A synthetic intermediate in the preparation of CNS depressants |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
