| Identification | |
| Name: | 4-Piperidinecarbonitrile,1-acetyl- |
| Synonyms: | Isonipecotonitrile,1-acetyl- (8CI); 1-Acetyl-4-cyanopiperidine |
| CAS: | 25503-91-7 |
| Molecular Formula: | C8H12 N2 O |
| Molecular Weight: | 152.19 |
| InChI: | InChI=1/C8H12N2O/c1-7(11)10-4-2-8(6-9)3-5-10/h8H,2-5H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Flash Point: | 158.8°C |
| Boiling Point: | 140 °C |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.494 |
| Appearance: | Yellow solid |
| Flash Point: | 158.8°C |
| Usage: | Intermediate in the preparation of CNS depressants. |
| Safety Data | |
 |
|
