| Identification | |
| Name: | 2H-1-Benzopyran-2-one,7-methoxy-4-methyl- |
| Synonyms: | Coumarin,7-methoxy-4-methyl- (7CI,8CI); Herniarin, 4-methyl- (6CI);4-Methyl-7-methoxycoumarin; 4-Methylherniarin; 4-Methylumbelliferone methylether; 7-Methoxy-4-methyl-2H-1-benzopyran-2-one;7-Methoxy-4-methyl-2H-chromen-2-one; 7-Methoxy-4-methylcoumarin; NSC 688805 |
| CAS: | 2555-28-4 |
| Molecular Formula: | C11H10 O3 |
| Molecular Weight: | 190.2 |
| InChI: | InChI=1/C11H10O3/c1-7-5-11(12)14-10-6-8(13-2)3-4-9(7)10/h3-6H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 340.1°Cat760mmHg |
| Boiling Point: | 340.1°Cat760mmHg |
| Density: | 1.195g/cm3 |
| Stability: | Moisture, Temperature Sensitive |
| Refractive index: | 1.556 |
| Specification: |
2H-1-Benzopyran-2-one,7-methoxy-4-methyl- , with CAS number of 2555-28-4, can be called 2(1H)-Benzopyran-2-one, 7-methoxy-4-methyl ; 2H-1-Benzopyran-2-one, 7-methoxy-4-methyl- ; 4-Methylherniarin ; 7-Methoxy-4-methyl-2H-chromen-2-one ; 7-Methoxy-4-methyl-chromen-2-one ; Coumarin, 7-methoxy-4-methyl- ; Herniarin, 4-methyl- .It is an of-wite slid. |
| Flash Point: | 340.1°Cat760mmHg |
| Usage: | Used for determination of Cytochrome P450 activity. |
| Safety Data | |
 |
|
