| Identification | |
| Name: | Acetic acid,2-[(ethoxythioxomethyl)thio]- |
| Synonyms: | Aceticacid, [(ethoxythioxomethyl)thio]- (9CI); Carbonic acid, dithio-, O-ethyl ester,S-ester with mercaptoacetic acid (8CI); Xanthic acid, ethyl-, carboxymethylester (6CI); Xanthic acid, ethyl-, ester with mercaptoacetic acid (7CI); Aceticacid, mercapto-, O-ethyl dithiocarbonate (8CI); Ethyl xanthogeneacetic acid;NSC 85743; S-(Carboxymethyl) O-ethyl dithiocarbonate; [(Ethoxythiocarbonyl)thio]aceticacid |
| CAS: | 25554-84-1 |
| Molecular Formula: | C5H8 O3 S2 |
| Molecular Weight: | 180.2452 |
| InChI: | InChI=1/C5H8O3S2/c1-2-8-5(9)10-3-4(6)7/h2-3H2,1H3,(H,6,7) |
| Molecular Structure: | ![(C5H8O3S2) Aceticacid, [(ethoxythioxomethyl)thio]- (9CI); Carbonic acid, dithio-, O-ethyl ester,S-ester with me...](https://img1.guidechem.com/chem/e/dict/37/25554-84-1.jpg) |
| Properties | |
| Flash Point: | 142.2°C |
| Boiling Point: | 311.5°Cat760mmHg |
| Density: | 1.375g/cm3 |
| Refractive index: | 1.583 |
| Flash Point: | 142.2°C |
| Safety Data | |
 |
|
