| Identification | |
| Name: | Benzene,[2-(1-ethoxyethoxy)ethyl]- |
| Synonyms: | Acetaldehyde,ethyl phenethyl acetal (7CI,8CI); Ethane, 1-ethoxy-1-(phenethyloxy)- (8CI);1-Ethoxy-1-(2'-phenylethoxy)ethane; Acetaldehyde ethyl 2-phenylethyl acetal;Efetaal |
| CAS: | 2556-10-7 |
| EINECS: | 2556-10-7 |
| Molecular Formula: | C12H18 O2 |
| Molecular Weight: | 194.27012 |
| InChI: | InChI=1S/C12H18O2/c1-3-13-11(2)14-10-9-12-7-5-4-6-8-12/h4-8,11H,3,9-10H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 77.7 ºC |
| Boiling Point: | 241.4 ºC at 760 mmHg |
| Density: | 0.964 g/cm3 |
| Refractive index: | 1.485 |
| Water Solubility: | Insoluble |
| Solubility: | Insoluble |
| Appearance: | pale yellow liquid |
| Specification: |
(2-(1-Ethoxyethoxy)ethyl)benzene ,its cas register number is 2556-10-7. It also can be called Acetaldehyde ethyl 2-phenylethyl acetal ; Ethyl phenethyl acetal ; Benzene, (2-(1-ethoxyethoxy)ethyl)-) and Acetaldehyde ethyl phenylethyl acetal . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 77.7 ºC |
| Safety Data | |
| Hazard Symbols | |
 |
|
