| Identification | |
| Name: | 2-Cyclopenten-1-one,2-pentyl- |
| Synonyms: | 2-Cyclopenten-1-one,2-amyl- (4CI); 2-(1-Pentyl)-2-cyclopenten-1-one; 2-Pentyl-1-cyclopenten-3-one;2-Pentyl-2-cyclopenten-1-one; 2-Pentyl-2-cyclopentenone;3-Oxo-2-pentyl-1-cyclopentene |
| CAS: | 25564-22-1 |
| EINECS: | 247-104-4 |
| Molecular Formula: | C10H16 O |
| Molecular Weight: | 152.26 |
| InChI: | InChI=1/C10H16O/c1-2-3-4-6-9-7-5-8-10(9)11/h7H,2-6,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 205 ºCF |
| Boiling Point: | 114-116 ºC15 mm Hg(lit.) |
| Refractive index: | n20/D 1.473(lit.) |
| Specification: |
2-Pentylcyclopent-2-en-1-one ,its cas register number is 25564-22-1. It also can be called Amyl cyclopentenone ; and 2-Cyclopenten-1-one, 2-pentyl- . |
| Report: |
2-Pentylcyclopent-2-en-1-one (CAS NO.25564-22-1) has been reported in EPA TSCA Inventory. |
| Flash Point: | 205 ºCF |
| Safety Data | |
 |
|
