| Identification | |
| Name: | 1,1'-Biphenyl,(1-methylethyl)- |
| Synonyms: | Biphenyl,isopropyl- (6CI,8CI); Isopropylbiphenyl; Isopropyldiphenyl;Monoisopropylbiphenyl; Suresol; Wemcol |
| CAS: | 25640-78-2 |
| EINECS: | 247-156-8 |
| Molecular Formula: | C15H16 |
| Molecular Weight: | 196.29 |
| InChI: | InChI=1/C15H16/c1-12(2)14-10-6-7-11-15(14)13-8-4-3-5-9-13/h3-12H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 133.3°C |
| Boiling Point: | 293.9°Cat760mmHg |
| Density: | 0.958g/cm3 |
| Refractive index: | 1.547 |
| Solubility: | In water = 0.6 mg/l at 25 deg C |
| Specification: |
Isopropyl biphenyl (25640-78-2),which also can be called for (1-Methylethyl)-1,1'-biphenyl ; 1,1'-Biphenyl,(1-methylethyl)- ; Biphenyl, isopropyl- ; HSDB 6160 ; Isopropylbiphenyl ; Isopropyldiphenyl ; Monoisopropylbiphenyl ; Wemcol .When Isopropyl biphenyl (25640-78-2) was heated, it emits acrid smoke and fumes. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 133.3°C |
| Color: | Water white |
| Safety Data | |
 |
|
