| Identification |
| Name: | Pyrazine,2-ethyl-3-methoxy- |
| Synonyms: | 2-Ethyl-3-methoxypyrazine;2-Methoxy-3-ethylpyrazine; |
| CAS: | 25680-58-4 |
| EINECS: | 247-184-0 |
| Molecular Formula: | C7H10N2O |
| Molecular Weight: | 138.17 |
| InChI: | InChI=1/C7H10N2O/c1-3-6-7(10-2)9-5-4-8-6/h4-5H,3H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.049 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.502 |
| Appearance: | Colorless liquid. |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
