| Identification | |
| Name: | Butanoic acid,3-[2-(2-ethoxy-1-methyl-2-oxoethylidene)hydrazinylidene]-, ethyl ester |
| Synonyms: | Acetoaceticacid, ethyl ester, 3,2-azine with ethyl pyruvate (8CI); Butanoic acid,3-[(2-ethoxy-1-methyl-2-oxoethylidene)hydrazono]-, ethyl ester (9CI); Pyruvicacid, ethyl ester, 2,3-azine with ethyl acetoacetate (8CI); NSC 108898 |
| CAS: | 25680-85-7 |
| Molecular Formula: | C11H18 N2 O4 |
| Molecular Weight: | 242.2716 |
| InChI: | InChI=1/C11H18N2O4/c1-5-16-10(14)7-8(3)12-13-9(4)11(15)17-6-2/h5-7H2,1-4H3/b12-8-,13-9- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.5°C |
| Boiling Point: | 324.2°Cat760mmHg |
| Density: | 1.08g/cm3 |
| Refractive index: | 1.477 |
| Flash Point: | 128.5°C |
| Safety Data | |
 |
|
