Identification |
Name: | Vinyl chloride, butyl acrylate resin |
Synonyms: | 2-Propenoic acid, butyl ester, polymer with chloroethene;2-propenoic acid, butyl ester, polymer withchloroethene;Vinyl chloride, butyl acrylate resin |
CAS: | 25702-34-5 |
Molecular Formula: | C9H15ClO2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H12O2.C2H3Cl/c1-3-5-6-9-7(8)4-2;1-2-3/h4H,2-3,5-6H2,1H3;2H,1H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 39.4°C |
Boiling Point: | 145.9°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 39.4°C |
Safety Data |
|
 |